About 2-ethyl-7-(iodomethyl)-4-(3-methoxypropyl)-2,6-dimethyl-1,4-benzoxazin-3-one
2-ethyl-7-(iodomethyl)-4-(3-methoxypropyl)-2,6-dimethyl-1,4-benzoxazin-3-one (PubChem CID 89423549) has the molecular formula C17H24INO3
and a molecular weight of 417.29 g/mol. Its IUPAC name is 2-ethyl-7-(iodomethyl)-4-(3-methoxypropyl)-2,6-dimethyl-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 2-ethyl-7-(iodomethyl)-4-(3-methoxypropyl)-2,6-dimethyl-1,4-benzoxazin-3-one |
| PubChem CID | 89423549 |
| Molecular Formula | C17H24INO3 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 2-ethyl-7-(iodomethyl)-4-(3-methoxypropyl)-2,6-dimethyl-1,4-benzoxazin-3-one |
| SMILES | CCC1(C)Oc2cc(CI)c(C)cc2N(CCCOC)C1=O |
| InChI | InChI=1S/C17H24INO3/c1-5-17(3)16(20)19(7-6-8-21-4)14-9-12(2)13(11-18)10-15(14)22-17/h9-10H,5-8,11H2,1-4H3 |
| InChIKey | QCUPYIQRYNRJDS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-7-(iodomethyl)-4-(3-methoxypropyl)-2,6-dimethyl-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-7-(iodomethyl)-4-(3-methoxypropyl)-2,6-dimethyl-1,4-benzoxazin-3-one?
The IUPAC name of 2-ethyl-7-(iodomethyl)-4-(3-methoxypropyl)-2,6-dimethyl-1,4-benzoxazin-3-one (CID 89423549) is 2-ethyl-7-(iodomethyl)-4-(3-methoxypropyl)-2,6-dimethyl-1,4-benzoxazin-3-one.
What is the SMILES notation for 2-ethyl-7-(iodomethyl)-4-(3-methoxypropyl)-2,6-dimethyl-1,4-benzoxazin-3-one?
The canonical SMILES for 2-ethyl-7-(iodomethyl)-4-(3-methoxypropyl)-2,6-dimethyl-1,4-benzoxazin-3-one is CCC1(C)Oc2cc(CI)c(C)cc2N(CCCOC)C1=O.
What is the InChIKey of 2-ethyl-7-(iodomethyl)-4-(3-methoxypropyl)-2,6-dimethyl-1,4-benzoxazin-3-one?
The InChIKey is QCUPYIQRYNRJDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24INO3/c1-5-17(3)16(20)19(7-6-8-21-4)14-9-12(2)13(11-18)10-15(14)22-17/h9-10H,5-8,11H2,1-4H3.
What are the key properties of 2-ethyl-7-(iodomethyl)-4-(3-methoxypropyl)-2,6-dimethyl-1,4-benzoxazin-3-one?
2-ethyl-7-(iodomethyl)-4-(3-methoxypropyl)-2,6-dimethyl-1,4-benzoxazin-3-one has a molecular weight of 417.29 g/mol, XLogP of 3.86, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-7-(iodomethyl)-4-(3-methoxypropyl)-2,6-dimethyl-1,4-benzoxazin-3-one is sourced from PubChem (CID 89423549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).