About 3-pentyl-5-propyl-1,2-dihydrotriazole
3-pentyl-5-propyl-1,2-dihydrotriazole (PubChem CID 89423625) has the molecular formula C10H21N3
and a molecular weight of 183.30 g/mol. Its IUPAC name is 3-pentyl-5-propyl-1,2-dihydrotriazole.
Molecular Properties
| Compound Name | 3-pentyl-5-propyl-1,2-dihydrotriazole |
| PubChem CID | 89423625 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 3-pentyl-5-propyl-1,2-dihydrotriazole |
| SMILES | CCCCCN1C=C(CCC)NN1 |
| InChI | InChI=1S/C10H21N3/c1-3-5-6-8-13-9-10(7-4-2)11-12-13/h9,11-12H,3-8H2,1-2H3 |
| InChIKey | OQWFYKZKADRMAB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pentyl-5-propyl-1,2-dihydrotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentyl-5-propyl-1,2-dihydrotriazole?
The IUPAC name of 3-pentyl-5-propyl-1,2-dihydrotriazole (CID 89423625) is 3-pentyl-5-propyl-1,2-dihydrotriazole.
What is the SMILES notation for 3-pentyl-5-propyl-1,2-dihydrotriazole?
The canonical SMILES for 3-pentyl-5-propyl-1,2-dihydrotriazole is CCCCCN1C=C(CCC)NN1.
What is the InChIKey of 3-pentyl-5-propyl-1,2-dihydrotriazole?
The InChIKey is OQWFYKZKADRMAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3/c1-3-5-6-8-13-9-10(7-4-2)11-12-13/h9,11-12H,3-8H2,1-2H3.
What are the key properties of 3-pentyl-5-propyl-1,2-dihydrotriazole?
3-pentyl-5-propyl-1,2-dihydrotriazole has a molecular weight of 183.30 g/mol, XLogP of 2.14, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentyl-5-propyl-1,2-dihydrotriazole is sourced from PubChem (CID 89423625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).