About (4Z,6Z)-7-amino-4-ethenylhepta-4,6-dien-1-ol
(4Z,6Z)-7-amino-4-ethenylhepta-4,6-dien-1-ol (PubChem CID 89423677) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is (4Z,6Z)-7-amino-4-ethenylhepta-4,6-dien-1-ol.
Molecular Properties
| Compound Name | (4Z,6Z)-7-amino-4-ethenylhepta-4,6-dien-1-ol |
| PubChem CID | 89423677 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (4Z,6Z)-7-amino-4-ethenylhepta-4,6-dien-1-ol |
| SMILES | C=C/C(=C\C=C/N)CCCO |
| InChI | InChI=1S/C9H15NO/c1-2-9(5-3-7-10)6-4-8-11/h2-3,5,7,11H,1,4,6,8,10H2/b7-3-,9-5+ |
| InChIKey | YGAVSISLTIFZTF-NINQLNBYSA-N |
| XLogP | 1.34 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z,6Z)-7-amino-4-ethenylhepta-4,6-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,6Z)-7-amino-4-ethenylhepta-4,6-dien-1-ol?
The IUPAC name of (4Z,6Z)-7-amino-4-ethenylhepta-4,6-dien-1-ol (CID 89423677) is (4Z,6Z)-7-amino-4-ethenylhepta-4,6-dien-1-ol.
What is the SMILES notation for (4Z,6Z)-7-amino-4-ethenylhepta-4,6-dien-1-ol?
The canonical SMILES for (4Z,6Z)-7-amino-4-ethenylhepta-4,6-dien-1-ol is C=C/C(=C\C=C/N)CCCO.
What is the InChIKey of (4Z,6Z)-7-amino-4-ethenylhepta-4,6-dien-1-ol?
The InChIKey is YGAVSISLTIFZTF-NINQLNBYSA-N. The full InChI is InChI=1S/C9H15NO/c1-2-9(5-3-7-10)6-4-8-11/h2-3,5,7,11H,1,4,6,8,10H2/b7-3-,9-5+.
What are the key properties of (4Z,6Z)-7-amino-4-ethenylhepta-4,6-dien-1-ol?
(4Z,6Z)-7-amino-4-ethenylhepta-4,6-dien-1-ol has a molecular weight of 153.22 g/mol, XLogP of 1.34, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,6Z)-7-amino-4-ethenylhepta-4,6-dien-1-ol is sourced from PubChem (CID 89423677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).