About (Z)-1-N-(methylideneamino)-1-N-(2-methylpropyl)hex-1-ene-1,2-diamine
(Z)-1-N-(methylideneamino)-1-N-(2-methylpropyl)hex-1-ene-1,2-diamine (PubChem CID 89423869) has the molecular formula C11H23N3
and a molecular weight of 197.33 g/mol. Its IUPAC name is (Z)-1-N-(methylideneamino)-1-N-(2-methylpropyl)hex-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | (Z)-1-N-(methylideneamino)-1-N-(2-methylpropyl)hex-1-ene-1,2-diamine |
| PubChem CID | 89423869 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | (Z)-1-N-(methylideneamino)-1-N-(2-methylpropyl)hex-1-ene-1,2-diamine |
| SMILES | C=NN(/C=C(\N)CCCC)CC(C)C |
| InChI | InChI=1S/C11H23N3/c1-5-6-7-11(12)9-14(13-4)8-10(2)3/h9-10H,4-8,12H2,1-3H3/b11-9- |
| InChIKey | XMKFEZSGNOFKRW-LUAWRHEFSA-N |
| XLogP | 2.55 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-N-(methylideneamino)-1-N-(2-methylpropyl)hex-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-N-(methylideneamino)-1-N-(2-methylpropyl)hex-1-ene-1,2-diamine?
The IUPAC name of (Z)-1-N-(methylideneamino)-1-N-(2-methylpropyl)hex-1-ene-1,2-diamine (CID 89423869) is (Z)-1-N-(methylideneamino)-1-N-(2-methylpropyl)hex-1-ene-1,2-diamine.
What is the SMILES notation for (Z)-1-N-(methylideneamino)-1-N-(2-methylpropyl)hex-1-ene-1,2-diamine?
The canonical SMILES for (Z)-1-N-(methylideneamino)-1-N-(2-methylpropyl)hex-1-ene-1,2-diamine is C=NN(/C=C(\N)CCCC)CC(C)C.
What is the InChIKey of (Z)-1-N-(methylideneamino)-1-N-(2-methylpropyl)hex-1-ene-1,2-diamine?
The InChIKey is XMKFEZSGNOFKRW-LUAWRHEFSA-N. The full InChI is InChI=1S/C11H23N3/c1-5-6-7-11(12)9-14(13-4)8-10(2)3/h9-10H,4-8,12H2,1-3H3/b11-9-.
What are the key properties of (Z)-1-N-(methylideneamino)-1-N-(2-methylpropyl)hex-1-ene-1,2-diamine?
(Z)-1-N-(methylideneamino)-1-N-(2-methylpropyl)hex-1-ene-1,2-diamine has a molecular weight of 197.33 g/mol, XLogP of 2.55, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-N-(methylideneamino)-1-N-(2-methylpropyl)hex-1-ene-1,2-diamine is sourced from PubChem (CID 89423869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).