About N-ethenyl-N'-propan-2-ylethane-1,2-diimine
N-ethenyl-N'-propan-2-ylethane-1,2-diimine (PubChem CID 89423960) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is N-ethenyl-N'-propan-2-ylethane-1,2-diimine.
Molecular Properties
| Compound Name | N-ethenyl-N'-propan-2-ylethane-1,2-diimine |
| PubChem CID | 89423960 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | N-ethenyl-N'-propan-2-ylethane-1,2-diimine |
| SMILES | C=C/N=C/C=N/C(C)C |
| InChI | InChI=1S/C7H12N2/c1-4-8-5-6-9-7(2)3/h4-7H,1H2,2-3H3/b8-5+,9-6+ |
| InChIKey | VQIDKOSSTGLIJH-XVYDYJIPSA-N |
| XLogP | 1.68 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-N'-propan-2-ylethane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N'-propan-2-ylethane-1,2-diimine?
The IUPAC name of N-ethenyl-N'-propan-2-ylethane-1,2-diimine (CID 89423960) is N-ethenyl-N'-propan-2-ylethane-1,2-diimine.
What is the SMILES notation for N-ethenyl-N'-propan-2-ylethane-1,2-diimine?
The canonical SMILES for N-ethenyl-N'-propan-2-ylethane-1,2-diimine is C=C/N=C/C=N/C(C)C.
What is the InChIKey of N-ethenyl-N'-propan-2-ylethane-1,2-diimine?
The InChIKey is VQIDKOSSTGLIJH-XVYDYJIPSA-N. The full InChI is InChI=1S/C7H12N2/c1-4-8-5-6-9-7(2)3/h4-7H,1H2,2-3H3/b8-5+,9-6+.
What are the key properties of N-ethenyl-N'-propan-2-ylethane-1,2-diimine?
N-ethenyl-N'-propan-2-ylethane-1,2-diimine has a molecular weight of 124.19 g/mol, XLogP of 1.68, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N'-propan-2-ylethane-1,2-diimine is sourced from PubChem (CID 89423960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).