C6H3Br2ClO2S — CID 89423982
5,7-dibromo-3-chloro-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 89423982) has the molecular formula C6H3Br2ClO2S and a molecular weight of 334.42 g/mol. Its IUPAC name is 5,7-dibromo-3-chloro-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5,7-dibromo-3-chloro-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 89423982 |
| Molecular Formula | C6H3Br2ClO2S |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 331.79 |
| IUPAC Name | 5,7-dibromo-3-chloro-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | ClC1COc2c(Br)sc(Br)c2O1 |
| InChI | InChI=1S/C6H3Br2ClO2S/c7-5-3-4(6(8)12-5)11-2(9)1-10-3/h2H,1H2 |
| InChIKey | CZKBHIIFLYQMJV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|