C20H24F6O3 — CID 89424032
[9-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 2-methylprop-2-enoate (PubChem CID 89424032) has the molecular formula C20H24F6O3 and a molecular weight of 426.40 g/mol. Its IUPAC name is [9-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 2-methylprop-2-enoate.
| Compound Name | [9-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89424032 |
| Molecular Formula | C20H24F6O3 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | [9-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC2CC1C1C3CC(CC(O)(C(F)(F)F)C(F)(F)F)C(C3)C21 |
| InChI | InChI=1S/C20H24F6O3/c1-8(2)17(27)29-14-6-10-5-13(14)16-9-3-11(12(4-9)15(10)16)7-18(28,19(21,22)23)20(24,25)26/h9-16,28H,1,3-7H2,2H3 |
| InChIKey | KEHILMXMUGUCDS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|