C13H19N3 — CID 89424278
(3Z)-4-[amino-[(3Z,5Z)-octa-1,3,5,7-tetraen-2-yl]amino]penta-1,3-dien-2-amine (PubChem CID 89424278) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is (3Z)-4-[amino-[(3Z,5Z)-octa-1,3,5,7-tetraen-2-yl]amino]penta-1,3-dien-2-amine.
| Compound Name | (3Z)-4-[amino-[(3Z,5Z)-octa-1,3,5,7-tetraen-2-yl]amino]penta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 89424278 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (3Z)-4-[amino-[(3Z,5Z)-octa-1,3,5,7-tetraen-2-yl]amino]penta-1,3-dien-2-amine |
| SMILES | C=C/C=C\C=C/C(=C)N(N)/C(C)=C\C(=C)N |
| InChI | InChI=1S/C13H19N3/c1-5-6-7-8-9-12(3)16(15)13(4)10-11(2)14/h5-10H,1-3,14-15H2,4H3/b7-6-,9-8-,13-10- |
| InChIKey | SFGNEEBNBYSENA-GFVAWKPRSA-N |
| XLogP | 2.35 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|