C19H20F3N3O — CID 89424301
(3Z)-4-(N-aminoanilino)-4-[3-(2,2,2-trifluoroethoxymethyl)phenyl]buta-1,3-dien-2-amine (PubChem CID 89424301) has the molecular formula C19H20F3N3O and a molecular weight of 363.38 g/mol. Its IUPAC name is (3Z)-4-(N-aminoanilino)-4-[3-(2,2,2-trifluoroethoxymethyl)phenyl]buta-1,3-dien-2-amine.
| Compound Name | (3Z)-4-(N-aminoanilino)-4-[3-(2,2,2-trifluoroethoxymethyl)phenyl]buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 89424301 |
| Molecular Formula | C19H20F3N3O |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (3Z)-4-(N-aminoanilino)-4-[3-(2,2,2-trifluoroethoxymethyl)phenyl]buta-1,3-dien-2-amine |
| SMILES | C=C(N)/C=C(/c1cccc(COCC(F)(F)F)c1)N(N)c1ccccc1 |
| InChI | InChI=1S/C19H20F3N3O/c1-14(23)10-18(25(24)17-8-3-2-4-9-17)16-7-5-6-15(11-16)12-26-13-19(20,21)22/h2-11H,1,12-13,23-24H2/b18-10- |
| InChIKey | GLYNESFNSIAAQV-ZDLGFXPLSA-N |
| XLogP | 3.96 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|