C10H9BF6O3 — CID 89424308
[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)phenyl]boronic acid (PubChem CID 89424308) has the molecular formula C10H9BF6O3 and a molecular weight of 301.98 g/mol. Its IUPAC name is [3-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)phenyl]boronic acid.
| Compound Name | [3-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 89424308 |
| Molecular Formula | C10H9BF6O3 |
| Molecular Weight | 301.98 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | [3-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)phenyl]boronic acid |
| SMILES | OB(O)c1cccc(COC(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9BF6O3/c12-9(13,14)8(10(15,16)17)20-5-6-2-1-3-7(4-6)11(18)19/h1-4,8,18-19H,5H2 |
| InChIKey | MDMVBQYRVQFFMJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.98 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|