C20H21FN4O2S — CID 8942444
1-[(4-fluorophenyl)methyl]-3-[[(3S)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]thiourea (PubChem CID 8942444) has the molecular formula C20H21FN4O2S and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[[(3S)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[[(3S)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 8942444 |
| Molecular Formula | C20H21FN4O2S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[[(3S)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]thiourea |
| SMILES | Cc1ccc(N2C[C@@H](C(=O)NNC(=S)NCc3ccc(F)cc3)CC2=O)cc1 |
| InChI | InChI=1S/C20H21FN4O2S/c1-13-2-8-17(9-3-13)25-12-15(10-18(25)26)19(27)23-24-20(28)22-11-14-4-6-16(21)7-5-14/h2-9,15H,10-12H2,1H3,(H,23,27)(H2,22,24,28)/t15-/m0/s1 |
| InChIKey | MWUKRYZQXVWIGP-HNNXBMFYSA-N |
| XLogP | 2.18 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|