C36H41BrN4O2Si — CID 89424953
2-bromo-N-[5-[hydroxy(dimethyl)silyl]-2,5-dimethylhexan-2-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 89424953) has the molecular formula C36H41BrN4O2Si and a molecular weight of 669.74 g/mol. Its IUPAC name is 2-bromo-N-[5-[hydroxy(dimethyl)silyl]-2,5-dimethylhexan-2-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-bromo-N-[5-[hydroxy(dimethyl)silyl]-2,5-dimethylhexan-2-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 89424953 |
| Molecular Formula | C36H41BrN4O2Si |
| Molecular Weight | 669.74 g/mol |
| Exact Mass | 668.22 |
| IUPAC Name | 2-bromo-N-[5-[hydroxy(dimethyl)silyl]-2,5-dimethylhexan-2-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)(CCC(C)(C)[Si](C)(C)O)NC(=O)c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ncc(Br)nc12 |
| InChI | InChI=1S/C36H41BrN4O2Si/c1-34(2,22-23-35(3,4)44(5,6)43)40-33(42)29-25-41(32-31(29)39-30(37)24-38-32)36(26-16-10-7-11-17-26,27-18-12-8-13-19-27)28-20-14-9-15-21-28/h7-21,24-25,43H,22-23H2,1-6H3,(H,40,42) |
| InChIKey | CNRZDJZOCGOYPV-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.74 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|