C19H15ClN4O2 — CID 89425336
2-[5-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-2-methylphenyl]-1-imidazo[1,2-a]pyridin-3-ylethanone (PubChem CID 89425336) has the molecular formula C19H15ClN4O2 and a molecular weight of 366.81 g/mol. Its IUPAC name is 2-[5-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-2-methylphenyl]-1-imidazo[1,2-a]pyridin-3-ylethanone.
| Compound Name | 2-[5-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-2-methylphenyl]-1-imidazo[1,2-a]pyridin-3-ylethanone |
|---|---|
| PubChem CID | 89425336 |
| Molecular Formula | C19H15ClN4O2 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-[5-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-2-methylphenyl]-1-imidazo[1,2-a]pyridin-3-ylethanone |
| SMILES | Cc1ccc(-c2noc(CCl)n2)cc1CC(=O)c1cnc2ccccn12 |
| InChI | InChI=1S/C19H15ClN4O2/c1-12-5-6-13(19-22-18(10-20)26-23-19)8-14(12)9-16(25)15-11-21-17-4-2-3-7-24(15)17/h2-8,11H,9-10H2,1H3 |
| InChIKey | JBUVGTYWQYXJST-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 73.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|