C30H49N9O10 — CID 89425550
3-(2-ethoxypropanoylamino)-N,N'-bis[1-[3-[3-(methylamino)-2,5-dioxopyrrolidin-1-yl]propanoylamino]ethyl]pentanediamide (PubChem CID 89425550) has the molecular formula C30H49N9O10 and a molecular weight of 695.78 g/mol. Its IUPAC name is 3-(2-ethoxypropanoylamino)-N,N'-bis[1-[3-[3-(methylamino)-2,5-dioxopyrrolidin-1-yl]propanoylamino]ethyl]pentanediamide.
| Compound Name | 3-(2-ethoxypropanoylamino)-N,N'-bis[1-[3-[3-(methylamino)-2,5-dioxopyrrolidin-1-yl]propanoylamino]ethyl]pentanediamide |
|---|---|
| PubChem CID | 89425550 |
| Molecular Formula | C30H49N9O10 |
| Molecular Weight | 695.78 g/mol |
| Exact Mass | 695.36 |
| IUPAC Name | 3-(2-ethoxypropanoylamino)-N,N'-bis[1-[3-[3-(methylamino)-2,5-dioxopyrrolidin-1-yl]propanoylamino]ethyl]pentanediamide |
| SMILES | CCOC(C)C(=O)NC(CC(=O)NC(C)NC(=O)CCN1C(=O)CC(NC)C1=O)CC(=O)NC(C)NC(=O)CCN1C(=O)CC(NC)C1=O |
| InChI | InChI=1S/C30H49N9O10/c1-7-49-16(2)28(46)37-19(12-24(42)35-17(3)33-22(40)8-10-38-26(44)14-20(31-5)29(38)47)13-25(43)36-18(4)34-23(41)9-11-39-27(45)15-21(32-6)30(39)48/h16-21,31-32H,7-15H2,1-6H3,(H,33,40)(H,34,41)(H,35,42)(H,36,43)(H,37,46) |
| InChIKey | SDSZNZKIRHOYII-UHFFFAOYSA-N |
| XLogP | -3.69 |
| TPSA | 253.55 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.78 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|