About 4-ethynyl-6-methyl-1,3-benzodioxole
4-ethynyl-6-methyl-1,3-benzodioxole (PubChem CID 89425862) has the molecular formula C10H8O2
and a molecular weight of 160.17 g/mol. Its IUPAC name is 4-ethynyl-6-methyl-1,3-benzodioxole.
Molecular Properties
| Compound Name | 4-ethynyl-6-methyl-1,3-benzodioxole |
| PubChem CID | 89425862 |
| Molecular Formula | C10H8O2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 4-ethynyl-6-methyl-1,3-benzodioxole |
| SMILES | C#Cc1cc(C)cc2c1OCO2 |
| InChI | InChI=1S/C10H8O2/c1-3-8-4-7(2)5-9-10(8)12-6-11-9/h1,4-5H,6H2,2H3 |
| InChIKey | MXGQLPSMVPRPDA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynyl-6-methyl-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynyl-6-methyl-1,3-benzodioxole?
The IUPAC name of 4-ethynyl-6-methyl-1,3-benzodioxole (CID 89425862) is 4-ethynyl-6-methyl-1,3-benzodioxole.
What is the SMILES notation for 4-ethynyl-6-methyl-1,3-benzodioxole?
The canonical SMILES for 4-ethynyl-6-methyl-1,3-benzodioxole is C#Cc1cc(C)cc2c1OCO2.
What is the InChIKey of 4-ethynyl-6-methyl-1,3-benzodioxole?
The InChIKey is MXGQLPSMVPRPDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2/c1-3-8-4-7(2)5-9-10(8)12-6-11-9/h1,4-5H,6H2,2H3.
What are the key properties of 4-ethynyl-6-methyl-1,3-benzodioxole?
4-ethynyl-6-methyl-1,3-benzodioxole has a molecular weight of 160.17 g/mol, XLogP of 1.71, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynyl-6-methyl-1,3-benzodioxole is sourced from PubChem (CID 89425862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).