About (Z)-2-amino-2-[4-(ethylamino)-3-fluorocyclohexa-1,3-dien-1-yl]ethenethiol
(Z)-2-amino-2-[4-(ethylamino)-3-fluorocyclohexa-1,3-dien-1-yl]ethenethiol (PubChem CID 89425971) has the molecular formula C10H15FN2S
and a molecular weight of 214.31 g/mol. Its IUPAC name is (Z)-2-amino-2-[4-(ethylamino)-3-fluorocyclohexa-1,3-dien-1-yl]ethenethiol.
Molecular Properties
| Compound Name | (Z)-2-amino-2-[4-(ethylamino)-3-fluorocyclohexa-1,3-dien-1-yl]ethenethiol |
| PubChem CID | 89425971 |
| Molecular Formula | C10H15FN2S |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | (Z)-2-amino-2-[4-(ethylamino)-3-fluorocyclohexa-1,3-dien-1-yl]ethenethiol |
| SMILES | CCNC1=C(F)C=C(/C(N)=C/S)CC1 |
| InChI | InChI=1S/C10H15FN2S/c1-2-13-10-4-3-7(5-8(10)11)9(12)6-14/h5-6,13-14H,2-4,12H2,1H3/b9-6- |
| InChIKey | RSLNWEJTFWMDGZ-TWGQIWQCSA-N |
| XLogP | 2.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-amino-2-[4-(ethylamino)-3-fluorocyclohexa-1,3-dien-1-yl]ethenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-amino-2-[4-(ethylamino)-3-fluorocyclohexa-1,3-dien-1-yl]ethenethiol?
The IUPAC name of (Z)-2-amino-2-[4-(ethylamino)-3-fluorocyclohexa-1,3-dien-1-yl]ethenethiol (CID 89425971) is (Z)-2-amino-2-[4-(ethylamino)-3-fluorocyclohexa-1,3-dien-1-yl]ethenethiol.
What is the SMILES notation for (Z)-2-amino-2-[4-(ethylamino)-3-fluorocyclohexa-1,3-dien-1-yl]ethenethiol?
The canonical SMILES for (Z)-2-amino-2-[4-(ethylamino)-3-fluorocyclohexa-1,3-dien-1-yl]ethenethiol is CCNC1=C(F)C=C(/C(N)=C/S)CC1.
What is the InChIKey of (Z)-2-amino-2-[4-(ethylamino)-3-fluorocyclohexa-1,3-dien-1-yl]ethenethiol?
The InChIKey is RSLNWEJTFWMDGZ-TWGQIWQCSA-N. The full InChI is InChI=1S/C10H15FN2S/c1-2-13-10-4-3-7(5-8(10)11)9(12)6-14/h5-6,13-14H,2-4,12H2,1H3/b9-6-.
What are the key properties of (Z)-2-amino-2-[4-(ethylamino)-3-fluorocyclohexa-1,3-dien-1-yl]ethenethiol?
(Z)-2-amino-2-[4-(ethylamino)-3-fluorocyclohexa-1,3-dien-1-yl]ethenethiol has a molecular weight of 214.31 g/mol, XLogP of 2.23, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-amino-2-[4-(ethylamino)-3-fluorocyclohexa-1,3-dien-1-yl]ethenethiol is sourced from PubChem (CID 89425971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).