About (Z)-2-amino-2-(5-ethoxycyclohexa-2,4-dien-1-yl)ethenethiol
(Z)-2-amino-2-(5-ethoxycyclohexa-2,4-dien-1-yl)ethenethiol (PubChem CID 89425993) has the molecular formula C10H15NOS
and a molecular weight of 197.30 g/mol. Its IUPAC name is (Z)-2-amino-2-(5-ethoxycyclohexa-2,4-dien-1-yl)ethenethiol.
Molecular Properties
| Compound Name | (Z)-2-amino-2-(5-ethoxycyclohexa-2,4-dien-1-yl)ethenethiol |
| PubChem CID | 89425993 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | (Z)-2-amino-2-(5-ethoxycyclohexa-2,4-dien-1-yl)ethenethiol |
| SMILES | CCOC1=CC=CC(/C(N)=C/S)C1 |
| InChI | InChI=1S/C10H15NOS/c1-2-12-9-5-3-4-8(6-9)10(11)7-13/h3-5,7-8,13H,2,6,11H2,1H3/b10-7- |
| InChIKey | LSKJGCJCYYUIDJ-YFHOEESVSA-N |
| XLogP | 2.21 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-amino-2-(5-ethoxycyclohexa-2,4-dien-1-yl)ethenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-amino-2-(5-ethoxycyclohexa-2,4-dien-1-yl)ethenethiol?
The IUPAC name of (Z)-2-amino-2-(5-ethoxycyclohexa-2,4-dien-1-yl)ethenethiol (CID 89425993) is (Z)-2-amino-2-(5-ethoxycyclohexa-2,4-dien-1-yl)ethenethiol.
What is the SMILES notation for (Z)-2-amino-2-(5-ethoxycyclohexa-2,4-dien-1-yl)ethenethiol?
The canonical SMILES for (Z)-2-amino-2-(5-ethoxycyclohexa-2,4-dien-1-yl)ethenethiol is CCOC1=CC=CC(/C(N)=C/S)C1.
What is the InChIKey of (Z)-2-amino-2-(5-ethoxycyclohexa-2,4-dien-1-yl)ethenethiol?
The InChIKey is LSKJGCJCYYUIDJ-YFHOEESVSA-N. The full InChI is InChI=1S/C10H15NOS/c1-2-12-9-5-3-4-8(6-9)10(11)7-13/h3-5,7-8,13H,2,6,11H2,1H3/b10-7-.
What are the key properties of (Z)-2-amino-2-(5-ethoxycyclohexa-2,4-dien-1-yl)ethenethiol?
(Z)-2-amino-2-(5-ethoxycyclohexa-2,4-dien-1-yl)ethenethiol has a molecular weight of 197.30 g/mol, XLogP of 2.21, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-amino-2-(5-ethoxycyclohexa-2,4-dien-1-yl)ethenethiol is sourced from PubChem (CID 89425993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).