C13H21NO2 — CID 89426190
(3E,5Z)-N-(2-methoxyethyl)-N-(oxiran-2-ylmethyl)hepta-1,3,5-trien-4-amine (PubChem CID 89426190) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is (3E,5Z)-N-(2-methoxyethyl)-N-(oxiran-2-ylmethyl)hepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5Z)-N-(2-methoxyethyl)-N-(oxiran-2-ylmethyl)hepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 89426190 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | (3E,5Z)-N-(2-methoxyethyl)-N-(oxiran-2-ylmethyl)hepta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(\C=C/C)N(CCOC)CC1CO1 |
| InChI | InChI=1S/C13H21NO2/c1-4-6-12(7-5-2)14(8-9-15-3)10-13-11-16-13/h4-7,13H,1,8-11H2,2-3H3/b7-5-,12-6+ |
| InChIKey | YWUQEWAZCHHAGT-NFWBANDSSA-N |
| XLogP | 1.98 |
| TPSA | 25.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|