C21H22ClN3O3S — CID 89426505
tert-butyl N-[5-(4-chlorophenyl)-7-methoxy-2-sulfanylidene-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamate (PubChem CID 89426505) has the molecular formula C21H22ClN3O3S and a molecular weight of 431.95 g/mol. Its IUPAC name is tert-butyl N-[5-(4-chlorophenyl)-7-methoxy-2-sulfanylidene-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[5-(4-chlorophenyl)-7-methoxy-2-sulfanylidene-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 89426505 |
| Molecular Formula | C21H22ClN3O3S |
| Molecular Weight | 431.95 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | tert-butyl N-[5-(4-chlorophenyl)-7-methoxy-2-sulfanylidene-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamate |
| SMILES | COc1ccc2c(c1)C(c1ccc(Cl)cc1)=NC(NC(=O)OC(C)(C)C)C(=S)N2 |
| InChI | InChI=1S/C21H22ClN3O3S/c1-21(2,3)28-20(26)25-18-19(29)23-16-10-9-14(27-4)11-15(16)17(24-18)12-5-7-13(22)8-6-12/h5-11,18H,1-4H3,(H,23,29)(H,25,26) |
| InChIKey | GZUOQOUGTNLBSQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.95 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|