C11H17NO4 — CID 89426695
(4R,5S)-1-[(1S)-1-methoxy-2-methylpropyl]-4-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 89426695) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is (4R,5S)-1-[(1S)-1-methoxy-2-methylpropyl]-4-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (4R,5S)-1-[(1S)-1-methoxy-2-methylpropyl]-4-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 89426695 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | (4R,5S)-1-[(1S)-1-methoxy-2-methylpropyl]-4-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | CO[C@@H](C(C)C)C12NC(=O)[C@H](C)C1OC2=O |
| InChI | InChI=1S/C11H17NO4/c1-5(2)7(15-4)11-8(16-10(11)14)6(3)9(13)12-11/h5-8H,1-4H3,(H,12,13)/t6-,7+,8?,11?/m1/s1 |
| InChIKey | FOLHHWQNXTWXDH-GIFGPCTOSA-N |
| XLogP | 0.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|