C13H13Cl2N3O — CID 89427130
N-[(3Z)-4-(aminomethylideneamino)-4-(3,4-dichlorophenyl)buta-1,3-dien-2-yl]acetamide (PubChem CID 89427130) has the molecular formula C13H13Cl2N3O and a molecular weight of 298.17 g/mol. Its IUPAC name is N-[(3Z)-4-(aminomethylideneamino)-4-(3,4-dichlorophenyl)buta-1,3-dien-2-yl]acetamide.
| Compound Name | N-[(3Z)-4-(aminomethylideneamino)-4-(3,4-dichlorophenyl)buta-1,3-dien-2-yl]acetamide |
|---|---|
| PubChem CID | 89427130 |
| Molecular Formula | C13H13Cl2N3O |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-[(3Z)-4-(aminomethylideneamino)-4-(3,4-dichlorophenyl)buta-1,3-dien-2-yl]acetamide |
| SMILES | C=C(/C=C(\N=C\N)c1ccc(Cl)c(Cl)c1)NC(C)=O |
| InChI | InChI=1S/C13H13Cl2N3O/c1-8(18-9(2)19)5-13(17-7-16)10-3-4-11(14)12(15)6-10/h3-7H,1H2,2H3,(H2,16,17)(H,18,19)/b13-5- |
| InChIKey | JFSXGAAXVZOXBK-ACAGNQJTSA-N |
| XLogP | 2.97 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|