C9H7F9O3Si — CID 89427471
2,2,2-trifluoro-1-[propyl-bis(2,2,2-trifluoroacetyl)silyl]ethanone (PubChem CID 89427471) has the molecular formula C9H7F9O3Si and a molecular weight of 362.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[propyl-bis(2,2,2-trifluoroacetyl)silyl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[propyl-bis(2,2,2-trifluoroacetyl)silyl]ethanone |
|---|---|
| PubChem CID | 89427471 |
| Molecular Formula | C9H7F9O3Si |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 2,2,2-trifluoro-1-[propyl-bis(2,2,2-trifluoroacetyl)silyl]ethanone |
| SMILES | CCC[Si](C(=O)C(F)(F)F)(C(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C9H7F9O3Si/c1-2-3-22(4(19)7(10,11)12,5(20)8(13,14)15)6(21)9(16,17)18/h2-3H2,1H3 |
| InChIKey | HVRQSEXYQIGISF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|