C8H5F9O3Si — CID 89427513
1-[ethyl-bis(2,2,2-trifluoroacetyl)silyl]-2,2,2-trifluoroethanone (PubChem CID 89427513) has the molecular formula C8H5F9O3Si and a molecular weight of 348.19 g/mol. Its IUPAC name is 1-[ethyl-bis(2,2,2-trifluoroacetyl)silyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[ethyl-bis(2,2,2-trifluoroacetyl)silyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 89427513 |
| Molecular Formula | C8H5F9O3Si |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 1-[ethyl-bis(2,2,2-trifluoroacetyl)silyl]-2,2,2-trifluoroethanone |
| SMILES | CC[Si](C(=O)C(F)(F)F)(C(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C8H5F9O3Si/c1-2-21(3(18)6(9,10)11,4(19)7(12,13)14)5(20)8(15,16)17/h2H2,1H3 |
| InChIKey | DFMQYEIIULGOLC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|