C8H10F6O2Si — CID 89427569
1-[diethyl-(2,2,2-trifluoroacetyl)silyl]-2,2,2-trifluoroethanone (PubChem CID 89427569) has the molecular formula C8H10F6O2Si and a molecular weight of 280.24 g/mol. Its IUPAC name is 1-[diethyl-(2,2,2-trifluoroacetyl)silyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[diethyl-(2,2,2-trifluoroacetyl)silyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 89427569 |
| Molecular Formula | C8H10F6O2Si |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 1-[diethyl-(2,2,2-trifluoroacetyl)silyl]-2,2,2-trifluoroethanone |
| SMILES | CC[Si](CC)(C(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C8H10F6O2Si/c1-3-17(4-2,5(15)7(9,10)11)6(16)8(12,13)14/h3-4H2,1-2H3 |
| InChIKey | JJAFSGRYAKWIEV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|