About 1-[acetyl-methyl-(3,3,3-trifluoropropyl)silyl]ethanone
1-[acetyl-methyl-(3,3,3-trifluoropropyl)silyl]ethanone (PubChem CID 89427585) has the molecular formula C8H13F3O2Si
and a molecular weight of 226.27 g/mol. Its IUPAC name is 1-[acetyl-methyl-(3,3,3-trifluoropropyl)silyl]ethanone.
Molecular Properties
| Compound Name | 1-[acetyl-methyl-(3,3,3-trifluoropropyl)silyl]ethanone |
| PubChem CID | 89427585 |
| Molecular Formula | C8H13F3O2Si |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 1-[acetyl-methyl-(3,3,3-trifluoropropyl)silyl]ethanone |
| SMILES | CC(=O)[Si](C)(CCC(F)(F)F)C(C)=O |
| InChI | InChI=1S/C8H13F3O2Si/c1-6(12)14(3,7(2)13)5-4-8(9,10)11/h4-5H2,1-3H3 |
| InChIKey | NDWQIXJNYWLDND-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[acetyl-methyl-(3,3,3-trifluoropropyl)silyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[acetyl-methyl-(3,3,3-trifluoropropyl)silyl]ethanone?
The IUPAC name of 1-[acetyl-methyl-(3,3,3-trifluoropropyl)silyl]ethanone (CID 89427585) is 1-[acetyl-methyl-(3,3,3-trifluoropropyl)silyl]ethanone.
What is the SMILES notation for 1-[acetyl-methyl-(3,3,3-trifluoropropyl)silyl]ethanone?
The canonical SMILES for 1-[acetyl-methyl-(3,3,3-trifluoropropyl)silyl]ethanone is CC(=O)[Si](C)(CCC(F)(F)F)C(C)=O.
What is the InChIKey of 1-[acetyl-methyl-(3,3,3-trifluoropropyl)silyl]ethanone?
The InChIKey is NDWQIXJNYWLDND-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3O2Si/c1-6(12)14(3,7(2)13)5-4-8(9,10)11/h4-5H2,1-3H3.
What are the key properties of 1-[acetyl-methyl-(3,3,3-trifluoropropyl)silyl]ethanone?
1-[acetyl-methyl-(3,3,3-trifluoropropyl)silyl]ethanone has a molecular weight of 226.27 g/mol, XLogP of 2.27, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[acetyl-methyl-(3,3,3-trifluoropropyl)silyl]ethanone is sourced from PubChem (CID 89427585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).