About 1-[bis(2,2-difluoroacetyl)-propylsilyl]-2,2-difluoroethanone
1-[bis(2,2-difluoroacetyl)-propylsilyl]-2,2-difluoroethanone (PubChem CID 89427600) has the molecular formula C9H10F6O3Si
and a molecular weight of 308.25 g/mol. Its IUPAC name is 1-[bis(2,2-difluoroacetyl)-propylsilyl]-2,2-difluoroethanone.
Molecular Properties
| Compound Name | 1-[bis(2,2-difluoroacetyl)-propylsilyl]-2,2-difluoroethanone |
| PubChem CID | 89427600 |
| Molecular Formula | C9H10F6O3Si |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 1-[bis(2,2-difluoroacetyl)-propylsilyl]-2,2-difluoroethanone |
| SMILES | CCC[Si](C(=O)C(F)F)(C(=O)C(F)F)C(=O)C(F)F |
| InChI | InChI=1S/C9H10F6O3Si/c1-2-3-19(7(16)4(10)11,8(17)5(12)13)9(18)6(14)15/h4-6H,2-3H2,1H3 |
| InChIKey | BEHIDANEAYDVRU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[bis(2,2-difluoroacetyl)-propylsilyl]-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bis(2,2-difluoroacetyl)-propylsilyl]-2,2-difluoroethanone?
The IUPAC name of 1-[bis(2,2-difluoroacetyl)-propylsilyl]-2,2-difluoroethanone (CID 89427600) is 1-[bis(2,2-difluoroacetyl)-propylsilyl]-2,2-difluoroethanone.
What is the SMILES notation for 1-[bis(2,2-difluoroacetyl)-propylsilyl]-2,2-difluoroethanone?
The canonical SMILES for 1-[bis(2,2-difluoroacetyl)-propylsilyl]-2,2-difluoroethanone is CCC[Si](C(=O)C(F)F)(C(=O)C(F)F)C(=O)C(F)F.
What is the InChIKey of 1-[bis(2,2-difluoroacetyl)-propylsilyl]-2,2-difluoroethanone?
The InChIKey is BEHIDANEAYDVRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F6O3Si/c1-2-3-19(7(16)4(10)11,8(17)5(12)13)9(18)6(14)15/h4-6H,2-3H2,1H3.
What are the key properties of 1-[bis(2,2-difluoroacetyl)-propylsilyl]-2,2-difluoroethanone?
1-[bis(2,2-difluoroacetyl)-propylsilyl]-2,2-difluoroethanone has a molecular weight of 308.25 g/mol, XLogP of 1.97, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bis(2,2-difluoroacetyl)-propylsilyl]-2,2-difluoroethanone is sourced from PubChem (CID 89427600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).