About 4-(ethylamino)-3,6-dimethyl-1H-pyridin-2-one
4-(ethylamino)-3,6-dimethyl-1H-pyridin-2-one (PubChem CID 89427682) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 4-(ethylamino)-3,6-dimethyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-(ethylamino)-3,6-dimethyl-1H-pyridin-2-one |
| PubChem CID | 89427682 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 4-(ethylamino)-3,6-dimethyl-1H-pyridin-2-one |
| SMILES | CCNc1cc(C)[nH]c(=O)c1C |
| InChI | InChI=1S/C9H14N2O/c1-4-10-8-5-6(2)11-9(12)7(8)3/h5H,4H2,1-3H3,(H2,10,11,12) |
| InChIKey | JOIZYQNCYHDDLE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(ethylamino)-3,6-dimethyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethylamino)-3,6-dimethyl-1H-pyridin-2-one?
The IUPAC name of 4-(ethylamino)-3,6-dimethyl-1H-pyridin-2-one (CID 89427682) is 4-(ethylamino)-3,6-dimethyl-1H-pyridin-2-one.
What is the SMILES notation for 4-(ethylamino)-3,6-dimethyl-1H-pyridin-2-one?
The canonical SMILES for 4-(ethylamino)-3,6-dimethyl-1H-pyridin-2-one is CCNc1cc(C)[nH]c(=O)c1C.
What is the InChIKey of 4-(ethylamino)-3,6-dimethyl-1H-pyridin-2-one?
The InChIKey is JOIZYQNCYHDDLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-4-10-8-5-6(2)11-9(12)7(8)3/h5H,4H2,1-3H3,(H2,10,11,12).
What are the key properties of 4-(ethylamino)-3,6-dimethyl-1H-pyridin-2-one?
4-(ethylamino)-3,6-dimethyl-1H-pyridin-2-one has a molecular weight of 166.22 g/mol, XLogP of 1.42, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethylamino)-3,6-dimethyl-1H-pyridin-2-one is sourced from PubChem (CID 89427682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).