C20H18FN5O3S — CID 89427711
[3-[[4-[(4-fluoro-2-methyl-1H-indol-5-yl)amino]pyrimidin-2-yl]amino]phenyl]methanesulfonic acid (PubChem CID 89427711) has the molecular formula C20H18FN5O3S and a molecular weight of 427.46 g/mol. Its IUPAC name is [3-[[4-[(4-fluoro-2-methyl-1H-indol-5-yl)amino]pyrimidin-2-yl]amino]phenyl]methanesulfonic acid.
| Compound Name | [3-[[4-[(4-fluoro-2-methyl-1H-indol-5-yl)amino]pyrimidin-2-yl]amino]phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 89427711 |
| Molecular Formula | C20H18FN5O3S |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | [3-[[4-[(4-fluoro-2-methyl-1H-indol-5-yl)amino]pyrimidin-2-yl]amino]phenyl]methanesulfonic acid |
| SMILES | Cc1cc2c(F)c(Nc3ccnc(Nc4cccc(CS(=O)(=O)O)c4)n3)ccc2[nH]1 |
| InChI | InChI=1S/C20H18FN5O3S/c1-12-9-15-16(23-12)5-6-17(19(15)21)25-18-7-8-22-20(26-18)24-14-4-2-3-13(10-14)11-30(27,28)29/h2-10,23H,11H2,1H3,(H,27,28,29)(H2,22,24,25,26) |
| InChIKey | SJJLQGLHFMSOOO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|