C21H22F3N3O5 — CID 89427904
[benzamido(methyl)amino] 5-(oxan-4-yl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate (PubChem CID 89427904) has the molecular formula C21H22F3N3O5 and a molecular weight of 453.42 g/mol. Its IUPAC name is [benzamido(methyl)amino] 5-(oxan-4-yl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate.
| Compound Name | [benzamido(methyl)amino] 5-(oxan-4-yl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 89427904 |
| Molecular Formula | C21H22F3N3O5 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | [benzamido(methyl)amino] 5-(oxan-4-yl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate |
| SMILES | CN(NC(=O)c1ccccc1)OC(=O)c1cnc(OCC(F)(F)F)c(C2CCOCC2)c1 |
| InChI | InChI=1S/C21H22F3N3O5/c1-27(26-18(28)15-5-3-2-4-6-15)32-20(29)16-11-17(14-7-9-30-10-8-14)19(25-12-16)31-13-21(22,23)24/h2-6,11-12,14H,7-10,13H2,1H3,(H,26,28) |
| InChIKey | HQLWSVRZDXIIFQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|