C21H25F3N2O5 — CID 89428087
trans-(2,2,2-trifluoroacetyl) (1S,2R)-1-[[(2R,3R)-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanoyl]amino]-2-phenylcyclopropane-1-carboxylate (PubChem CID 89428087) has the molecular formula C21H25F3N2O5 and a molecular weight of 442.43 g/mol. Its IUPAC name is trans-(2,2,2-trifluoroacetyl) (1S,2R)-1-[[(2R,3R)-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanoyl]amino]-2-phenylcyclopropane-1-carboxylate.
| Compound Name | trans-(2,2,2-trifluoroacetyl) (1S,2R)-1-[[(2R,3R)-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanoyl]amino]-2-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 89428087 |
| Molecular Formula | C21H25F3N2O5 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | trans-(2,2,2-trifluoroacetyl) (1S,2R)-1-[[(2R,3R)-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanoyl]amino]-2-phenylcyclopropane-1-carboxylate |
| SMILES | CO[C@@H]([C@@H]1CCCN1)[C@@H](C)C(=O)N[C@@]1(C(=O)OC(=O)C(F)(F)F)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H25F3N2O5/c1-12(16(30-2)15-9-6-10-25-15)17(27)26-20(18(28)31-19(29)21(22,23)24)11-14(20)13-7-4-3-5-8-13/h3-5,7-8,12,14-16,25H,6,9-11H2,1-2H3,(H,26,27)/t12-,14-,15+,16-,20+/m1/s1 |
| InChIKey | PVUOLGKOTDOVFR-CTXHMNPMSA-N |
| XLogP | 2.06 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|