About [(1S,8R)-4,5-dibromo-9-(hydroxymethyl)-9-bicyclo[6.1.0]nonanyl]methanol
[(1S,8R)-4,5-dibromo-9-(hydroxymethyl)-9-bicyclo[6.1.0]nonanyl]methanol (PubChem CID 89428104) has the molecular formula C11H18Br2O2
and a molecular weight of 342.07 g/mol. Its IUPAC name is [(1S,8R)-4,5-dibromo-9-(hydroxymethyl)-9-bicyclo[6.1.0]nonanyl]methanol.
Molecular Properties
| Compound Name | [(1S,8R)-4,5-dibromo-9-(hydroxymethyl)-9-bicyclo[6.1.0]nonanyl]methanol |
| PubChem CID | 89428104 |
| Molecular Formula | C11H18Br2O2 |
| Molecular Weight | 342.07 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | [(1S,8R)-4,5-dibromo-9-(hydroxymethyl)-9-bicyclo[6.1.0]nonanyl]methanol |
| SMILES | OCC1(CO)[C@@H]2CCC(Br)C(Br)CC[C@@H]21 |
| InChI | InChI=1S/C11H18Br2O2/c12-9-3-1-7-8(2-4-10(9)13)11(7,5-14)6-15/h7-10,14-15H,1-6H2/t7-,8+,9?,10? |
| InChIKey | CSEJIBCECFLAQU-BQKDNTBBSA-N |
| XLogP | 2.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.07 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(1S,8R)-4,5-dibromo-9-(hydroxymethyl)-9-bicyclo[6.1.0]nonanyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,8R)-4,5-dibromo-9-(hydroxymethyl)-9-bicyclo[6.1.0]nonanyl]methanol?
The IUPAC name of [(1S,8R)-4,5-dibromo-9-(hydroxymethyl)-9-bicyclo[6.1.0]nonanyl]methanol (CID 89428104) is [(1S,8R)-4,5-dibromo-9-(hydroxymethyl)-9-bicyclo[6.1.0]nonanyl]methanol.
What is the SMILES notation for [(1S,8R)-4,5-dibromo-9-(hydroxymethyl)-9-bicyclo[6.1.0]nonanyl]methanol?
The canonical SMILES for [(1S,8R)-4,5-dibromo-9-(hydroxymethyl)-9-bicyclo[6.1.0]nonanyl]methanol is OCC1(CO)[C@@H]2CCC(Br)C(Br)CC[C@@H]21.
What is the InChIKey of [(1S,8R)-4,5-dibromo-9-(hydroxymethyl)-9-bicyclo[6.1.0]nonanyl]methanol?
The InChIKey is CSEJIBCECFLAQU-BQKDNTBBSA-N. The full InChI is InChI=1S/C11H18Br2O2/c12-9-3-1-7-8(2-4-10(9)13)11(7,5-14)6-15/h7-10,14-15H,1-6H2/t7-,8+,9?,10?.
What are the key properties of [(1S,8R)-4,5-dibromo-9-(hydroxymethyl)-9-bicyclo[6.1.0]nonanyl]methanol?
[(1S,8R)-4,5-dibromo-9-(hydroxymethyl)-9-bicyclo[6.1.0]nonanyl]methanol has a molecular weight of 342.07 g/mol, XLogP of 2.30, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,8R)-4,5-dibromo-9-(hydroxymethyl)-9-bicyclo[6.1.0]nonanyl]methanol is sourced from PubChem (CID 89428104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).