C11H16F3NO4 — CID 89428136
(2,2,2-trifluoroacetyl) (2R,3R)-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanoate (PubChem CID 89428136) has the molecular formula C11H16F3NO4 and a molecular weight of 283.25 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2R,3R)-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) (2R,3R)-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanoate |
|---|---|
| PubChem CID | 89428136 |
| Molecular Formula | C11H16F3NO4 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2R,3R)-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanoate |
| SMILES | CO[C@@H]([C@@H]1CCCN1)[C@@H](C)C(=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H16F3NO4/c1-6(8(18-2)7-4-3-5-15-7)9(16)19-10(17)11(12,13)14/h6-8,15H,3-5H2,1-2H3/t6-,7+,8-/m1/s1 |
| InChIKey | SAZQAELXUNASPR-GJMOJQLCSA-N |
| XLogP | 1.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|