C13H18F3N3O3 — CID 89428211
N-[4-(2,5-dioxopyrrol-1-yl)butyl]-2,2,2-trifluoro-N-[2-(methylamino)ethyl]acetamide (PubChem CID 89428211) has the molecular formula C13H18F3N3O3 and a molecular weight of 321.30 g/mol. Its IUPAC name is N-[4-(2,5-dioxopyrrol-1-yl)butyl]-2,2,2-trifluoro-N-[2-(methylamino)ethyl]acetamide.
| Compound Name | N-[4-(2,5-dioxopyrrol-1-yl)butyl]-2,2,2-trifluoro-N-[2-(methylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 89428211 |
| Molecular Formula | C13H18F3N3O3 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N-[4-(2,5-dioxopyrrol-1-yl)butyl]-2,2,2-trifluoro-N-[2-(methylamino)ethyl]acetamide |
| SMILES | CNCCN(CCCCN1C(=O)C=CC1=O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C13H18F3N3O3/c1-17-6-9-18(12(22)13(14,15)16)7-2-3-8-19-10(20)4-5-11(19)21/h4-5,17H,2-3,6-9H2,1H3 |
| InChIKey | CFQIZULFPDOVNK-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|