C22H18ClF6NS — CID 89428574
3-[2-[3,5-bis(trifluoromethyl)phenyl]-6-methylphenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium chloride (PubChem CID 89428574) has the molecular formula C22H18ClF6NS and a molecular weight of 477.90 g/mol. Its IUPAC name is 3-[2-[3,5-bis(trifluoromethyl)phenyl]-6-methylphenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium chloride.
| Compound Name | 3-[2-[3,5-bis(trifluoromethyl)phenyl]-6-methylphenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium chloride |
|---|---|
| PubChem CID | 89428574 |
| Molecular Formula | C22H18ClF6NS |
| Molecular Weight | 477.90 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 3-[2-[3,5-bis(trifluoromethyl)phenyl]-6-methylphenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium chloride |
| SMILES | Cc1cccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1-[n+]1csc2c1CCCC2.[Cl-] |
| InChI | InChI=1S/C22H18F6NS.ClH/c1-13-5-4-6-17(20(13)29-12-30-19-8-3-2-7-18(19)29)14-9-15(21(23,24)25)11-16(10-14)22(26,27)28;/h4-6,9-12H,2-3,7-8H2,1H3;1H/q+1;/p-1 |
| InChIKey | YTFCIXQTHZADOU-UHFFFAOYSA-M |
| XLogP | 3.92 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.90 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|