C29H18ClF12NS — CID 89428671
3-[2,6-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium chloride (PubChem CID 89428671) has the molecular formula C29H18ClF12NS and a molecular weight of 675.97 g/mol. Its IUPAC name is 3-[2,6-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium chloride.
| Compound Name | 3-[2,6-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium chloride |
|---|---|
| PubChem CID | 89428671 |
| Molecular Formula | C29H18ClF12NS |
| Molecular Weight | 675.97 g/mol |
| Exact Mass | 675.07 |
| IUPAC Name | 3-[2,6-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium chloride |
| SMILES | FC(F)(F)c1cc(-c2cccc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2-[n+]2csc3c2CCCC3)cc(C(F)(F)F)c1.[Cl-] |
| InChI | InChI=1S/C29H18F12NS.ClH/c30-26(31,32)17-8-15(9-18(12-17)27(33,34)35)21-4-3-5-22(25(21)42-14-43-24-7-2-1-6-23(24)42)16-10-19(28(36,37)38)13-20(11-16)29(39,40)41;/h3-5,8-14H,1-2,6-7H2;1H/q+1;/p-1 |
| InChIKey | YWSLJFAAMICADB-UHFFFAOYSA-M |
| XLogP | 7.32 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.97 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|