About magnesium;1,3-ditert-butylbenzene-5-ide;iodide
magnesium;1,3-ditert-butylbenzene-5-ide;iodide (PubChem CID 89428717) has the molecular formula C14H21IMg
and a molecular weight of 340.53 g/mol. Its IUPAC name is magnesium;1,3-ditert-butylbenzene-5-ide;iodide.
Molecular Properties
| Compound Name | magnesium;1,3-ditert-butylbenzene-5-ide;iodide |
| PubChem CID | 89428717 |
| Molecular Formula | C14H21IMg |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | magnesium;1,3-ditert-butylbenzene-5-ide;iodide |
| SMILES | CC(C)(C)c1c[c-]cc(C(C)(C)C)c1.[I-].[Mg+2] |
| InChI | InChI=1S/C14H21.HI.Mg/c1-13(2,3)11-8-7-9-12(10-11)14(4,5)6;;/h8-10H,1-6H3;1H;/q-1;;+2/p-1 |
| InChIKey | USXGOYDOQHJOOG-UHFFFAOYSA-M |
| XLogP | 0.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze magnesium;1,3-ditert-butylbenzene-5-ide;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1,3-ditert-butylbenzene-5-ide;iodide?
The IUPAC name of magnesium;1,3-ditert-butylbenzene-5-ide;iodide (CID 89428717) is magnesium;1,3-ditert-butylbenzene-5-ide;iodide.
What is the SMILES notation for magnesium;1,3-ditert-butylbenzene-5-ide;iodide?
The canonical SMILES for magnesium;1,3-ditert-butylbenzene-5-ide;iodide is CC(C)(C)c1c[c-]cc(C(C)(C)C)c1.[I-].[Mg+2].
What is the InChIKey of magnesium;1,3-ditert-butylbenzene-5-ide;iodide?
The InChIKey is USXGOYDOQHJOOG-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H21.HI.Mg/c1-13(2,3)11-8-7-9-12(10-11)14(4,5)6;;/h8-10H,1-6H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;1,3-ditert-butylbenzene-5-ide;iodide?
magnesium;1,3-ditert-butylbenzene-5-ide;iodide has a molecular weight of 340.53 g/mol, XLogP of 0.70, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1,3-ditert-butylbenzene-5-ide;iodide is sourced from PubChem (CID 89428717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).