About 2-(2-methyl-1,3-thiazol-5-yl)ethyl acetate
2-(2-methyl-1,3-thiazol-5-yl)ethyl acetate (PubChem CID 89428725) has the molecular formula C8H11NO2S
and a molecular weight of 185.25 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-5-yl)ethyl acetate.
Molecular Properties
| Compound Name | 2-(2-methyl-1,3-thiazol-5-yl)ethyl acetate |
| PubChem CID | 89428725 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-5-yl)ethyl acetate |
| SMILES | CC(=O)OCCc1cnc(C)s1 |
| InChI | InChI=1S/C8H11NO2S/c1-6-9-5-8(12-6)3-4-11-7(2)10/h5H,3-4H2,1-2H3 |
| InChIKey | NJXQSLHCIMPAHH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-methyl-1,3-thiazol-5-yl)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-1,3-thiazol-5-yl)ethyl acetate?
The IUPAC name of 2-(2-methyl-1,3-thiazol-5-yl)ethyl acetate (CID 89428725) is 2-(2-methyl-1,3-thiazol-5-yl)ethyl acetate.
What is the SMILES notation for 2-(2-methyl-1,3-thiazol-5-yl)ethyl acetate?
The canonical SMILES for 2-(2-methyl-1,3-thiazol-5-yl)ethyl acetate is CC(=O)OCCc1cnc(C)s1.
What is the InChIKey of 2-(2-methyl-1,3-thiazol-5-yl)ethyl acetate?
The InChIKey is NJXQSLHCIMPAHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S/c1-6-9-5-8(12-6)3-4-11-7(2)10/h5H,3-4H2,1-2H3.
What are the key properties of 2-(2-methyl-1,3-thiazol-5-yl)ethyl acetate?
2-(2-methyl-1,3-thiazol-5-yl)ethyl acetate has a molecular weight of 185.25 g/mol, XLogP of 1.56, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-1,3-thiazol-5-yl)ethyl acetate is sourced from PubChem (CID 89428725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).