C20H36O4 — CID 89428786
[(2Z)-3,7-dimethylocta-2,6-dienyl] 3-methylbutanoate;3-methylbutanoic acid (PubChem CID 89428786) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is [(2Z)-3,7-dimethylocta-2,6-dienyl] 3-methylbutanoate;3-methylbutanoic acid.
| Compound Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] 3-methylbutanoate;3-methylbutanoic acid |
|---|---|
| PubChem CID | 89428786 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] 3-methylbutanoate;3-methylbutanoic acid |
| SMILES | CC(C)=CCC/C(C)=C\COC(=O)CC(C)C.CC(C)CC(=O)O |
| InChI | InChI=1S/C15H26O2.C5H10O2/c1-12(2)7-6-8-14(5)9-10-17-15(16)11-13(3)4;1-4(2)3-5(6)7/h7,9,13H,6,8,10-11H2,1-5H3;4H,3H2,1-2H3,(H,6,7)/b14-9-; |
| InChIKey | YCLNTVHSPKDNIV-WQRRWHLMSA-N |
| XLogP | 5.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|