About methanol;2-nitrobutan-1-ol
methanol;2-nitrobutan-1-ol (PubChem CID 89428843) has the molecular formula C6H17NO5
and a molecular weight of 183.20 g/mol. Its IUPAC name is methanol;2-nitrobutan-1-ol.
Molecular Properties
| Compound Name | methanol;2-nitrobutan-1-ol |
| PubChem CID | 89428843 |
| Molecular Formula | C6H17NO5 |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | methanol;2-nitrobutan-1-ol |
| SMILES | CCC(CO)[N+](=O)[O-].CO.CO |
| InChI | InChI=1S/C4H9NO3.2CH4O/c1-2-4(3-6)5(7)8;2*1-2/h4,6H,2-3H2,1H3;2*2H,1H3 |
| InChIKey | RSUSAWCWDRELRL-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methanol;2-nitrobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-nitrobutan-1-ol?
The IUPAC name of methanol;2-nitrobutan-1-ol (CID 89428843) is methanol;2-nitrobutan-1-ol.
What is the SMILES notation for methanol;2-nitrobutan-1-ol?
The canonical SMILES for methanol;2-nitrobutan-1-ol is CCC(CO)[N+](=O)[O-].CO.CO.
What is the InChIKey of methanol;2-nitrobutan-1-ol?
The InChIKey is RSUSAWCWDRELRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO3.2CH4O/c1-2-4(3-6)5(7)8;2*1-2/h4,6H,2-3H2,1H3;2*2H,1H3.
What are the key properties of methanol;2-nitrobutan-1-ol?
methanol;2-nitrobutan-1-ol has a molecular weight of 183.20 g/mol, XLogP of -0.75, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-nitrobutan-1-ol is sourced from PubChem (CID 89428843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).