About 2,6-diethoxy-6-prop-2-enylcyclohexa-2,4-dien-1-ol
2,6-diethoxy-6-prop-2-enylcyclohexa-2,4-dien-1-ol (PubChem CID 89429073) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is 2,6-diethoxy-6-prop-2-enylcyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 2,6-diethoxy-6-prop-2-enylcyclohexa-2,4-dien-1-ol |
| PubChem CID | 89429073 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 2,6-diethoxy-6-prop-2-enylcyclohexa-2,4-dien-1-ol |
| SMILES | C=CCC1(OCC)C=CC=C(OCC)C1O |
| InChI | InChI=1S/C13H20O3/c1-4-9-13(16-6-3)10-7-8-11(12(13)14)15-5-2/h4,7-8,10,12,14H,1,5-6,9H2,2-3H3 |
| InChIKey | JXAVCXOUVCYWNH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diethoxy-6-prop-2-enylcyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diethoxy-6-prop-2-enylcyclohexa-2,4-dien-1-ol?
The IUPAC name of 2,6-diethoxy-6-prop-2-enylcyclohexa-2,4-dien-1-ol (CID 89429073) is 2,6-diethoxy-6-prop-2-enylcyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 2,6-diethoxy-6-prop-2-enylcyclohexa-2,4-dien-1-ol?
The canonical SMILES for 2,6-diethoxy-6-prop-2-enylcyclohexa-2,4-dien-1-ol is C=CCC1(OCC)C=CC=C(OCC)C1O.
What is the InChIKey of 2,6-diethoxy-6-prop-2-enylcyclohexa-2,4-dien-1-ol?
The InChIKey is JXAVCXOUVCYWNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3/c1-4-9-13(16-6-3)10-7-8-11(12(13)14)15-5-2/h4,7-8,10,12,14H,1,5-6,9H2,2-3H3.
What are the key properties of 2,6-diethoxy-6-prop-2-enylcyclohexa-2,4-dien-1-ol?
2,6-diethoxy-6-prop-2-enylcyclohexa-2,4-dien-1-ol has a molecular weight of 224.30 g/mol, XLogP of 2.19, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diethoxy-6-prop-2-enylcyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 89429073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).