About 10-[(1,4-dioxonaphthalen-2-yl)amino]decyl methanesulfonate
10-[(1,4-dioxonaphthalen-2-yl)amino]decyl methanesulfonate (PubChem CID 89429105) has the molecular formula C21H29NO5S
and a molecular weight of 407.53 g/mol. Its IUPAC name is 10-[(1,4-dioxonaphthalen-2-yl)amino]decyl methanesulfonate.
Molecular Properties
| Compound Name | 10-[(1,4-dioxonaphthalen-2-yl)amino]decyl methanesulfonate |
| PubChem CID | 89429105 |
| Molecular Formula | C21H29NO5S |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 10-[(1,4-dioxonaphthalen-2-yl)amino]decyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCCCCCCCCNC1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H29NO5S/c1-28(25,26)27-15-11-7-5-3-2-4-6-10-14-22-19-16-20(23)17-12-8-9-13-18(17)21(19)24/h8-9,12-13,16,22H,2-7,10-11,14-15H2,1H3 |
| InChIKey | PECXPMLSSLSIEA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 10-[(1,4-dioxonaphthalen-2-yl)amino]decyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[(1,4-dioxonaphthalen-2-yl)amino]decyl methanesulfonate?
The IUPAC name of 10-[(1,4-dioxonaphthalen-2-yl)amino]decyl methanesulfonate (CID 89429105) is 10-[(1,4-dioxonaphthalen-2-yl)amino]decyl methanesulfonate.
What is the SMILES notation for 10-[(1,4-dioxonaphthalen-2-yl)amino]decyl methanesulfonate?
The canonical SMILES for 10-[(1,4-dioxonaphthalen-2-yl)amino]decyl methanesulfonate is CS(=O)(=O)OCCCCCCCCCCNC1=CC(=O)c2ccccc2C1=O.
What is the InChIKey of 10-[(1,4-dioxonaphthalen-2-yl)amino]decyl methanesulfonate?
The InChIKey is PECXPMLSSLSIEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29NO5S/c1-28(25,26)27-15-11-7-5-3-2-4-6-10-14-22-19-16-20(23)17-12-8-9-13-18(17)21(19)24/h8-9,12-13,16,22H,2-7,10-11,14-15H2,1H3.
What are the key properties of 10-[(1,4-dioxonaphthalen-2-yl)amino]decyl methanesulfonate?
10-[(1,4-dioxonaphthalen-2-yl)amino]decyl methanesulfonate has a molecular weight of 407.53 g/mol, XLogP of 3.64, 13 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[(1,4-dioxonaphthalen-2-yl)amino]decyl methanesulfonate is sourced from PubChem (CID 89429105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).