C25H55N5O6S+2 — CID 89429190
[[6-carbamoyl-2,2-dimethyl-4-[[(2-methyl-1-sulfopropan-2-yl)amino]methyl]octanoyl]amino]methyl-[2-hydroxy-3-(trimethylazaniumyl)propyl]-dimethylazanium (PubChem CID 89429190) has the molecular formula C25H55N5O6S+2 and a molecular weight of 553.81 g/mol. Its IUPAC name is [[6-carbamoyl-2,2-dimethyl-4-[[(2-methyl-1-sulfopropan-2-yl)amino]methyl]octanoyl]amino]methyl-[2-hydroxy-3-(trimethylazaniumyl)propyl]-dimethylazanium.
| Compound Name | [[6-carbamoyl-2,2-dimethyl-4-[[(2-methyl-1-sulfopropan-2-yl)amino]methyl]octanoyl]amino]methyl-[2-hydroxy-3-(trimethylazaniumyl)propyl]-dimethylazanium |
|---|---|
| PubChem CID | 89429190 |
| Molecular Formula | C25H55N5O6S+2 |
| Molecular Weight | 553.81 g/mol |
| Exact Mass | 553.39 |
| IUPAC Name | [[6-carbamoyl-2,2-dimethyl-4-[[(2-methyl-1-sulfopropan-2-yl)amino]methyl]octanoyl]amino]methyl-[2-hydroxy-3-(trimethylazaniumyl)propyl]-dimethylazanium |
| SMILES | CCC(CC(CNC(C)(C)CS(=O)(=O)O)CC(C)(C)C(=O)NC[N+](C)(C)CC(O)C[N+](C)(C)C)C(N)=O |
| InChI | InChI=1S/C25H53N5O6S/c1-11-20(22(26)32)12-19(14-28-25(4,5)17-37(34,35)36)13-24(2,3)23(33)27-18-30(9,10)16-21(31)15-29(6,7)8/h19-21,28,31H,11-18H2,1-10H3,(H2-2,26,27,32,33,34,35,36)/p+2 |
| InChIKey | OEJOPHLVQLCFMQ-UHFFFAOYSA-P |
| XLogP | 0.39 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.81 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|