About (3Z,5Z)-N-methyl-2-methylidenehepta-3,5-dien-1-amine
(3Z,5Z)-N-methyl-2-methylidenehepta-3,5-dien-1-amine (PubChem CID 89431220) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is (3Z,5Z)-N-methyl-2-methylidenehepta-3,5-dien-1-amine.
Molecular Properties
| Compound Name | (3Z,5Z)-N-methyl-2-methylidenehepta-3,5-dien-1-amine |
| PubChem CID | 89431220 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (3Z,5Z)-N-methyl-2-methylidenehepta-3,5-dien-1-amine |
| SMILES | C=C(/C=C\C=C/C)CNC |
| InChI | InChI=1S/C9H15N/c1-4-5-6-7-9(2)8-10-3/h4-7,10H,2,8H2,1,3H3/b5-4-,7-6- |
| InChIKey | RJWLVAVYCRWXIG-RZSVFLSASA-N |
| XLogP | 1.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5Z)-N-methyl-2-methylidenehepta-3,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5Z)-N-methyl-2-methylidenehepta-3,5-dien-1-amine?
The IUPAC name of (3Z,5Z)-N-methyl-2-methylidenehepta-3,5-dien-1-amine (CID 89431220) is (3Z,5Z)-N-methyl-2-methylidenehepta-3,5-dien-1-amine.
What is the SMILES notation for (3Z,5Z)-N-methyl-2-methylidenehepta-3,5-dien-1-amine?
The canonical SMILES for (3Z,5Z)-N-methyl-2-methylidenehepta-3,5-dien-1-amine is C=C(/C=C\C=C/C)CNC.
What is the InChIKey of (3Z,5Z)-N-methyl-2-methylidenehepta-3,5-dien-1-amine?
The InChIKey is RJWLVAVYCRWXIG-RZSVFLSASA-N. The full InChI is InChI=1S/C9H15N/c1-4-5-6-7-9(2)8-10-3/h4-7,10H,2,8H2,1,3H3/b5-4-,7-6-.
What are the key properties of (3Z,5Z)-N-methyl-2-methylidenehepta-3,5-dien-1-amine?
(3Z,5Z)-N-methyl-2-methylidenehepta-3,5-dien-1-amine has a molecular weight of 137.23 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z)-N-methyl-2-methylidenehepta-3,5-dien-1-amine is sourced from PubChem (CID 89431220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).