C14H19N3O — CID 89431380
1-(1,5-dimethylimidazol-2-yl)-N-[(1Z,3Z,5Z)-2-methoxyhepta-1,3,5-trienyl]methanimine (PubChem CID 89431380) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 1-(1,5-dimethylimidazol-2-yl)-N-[(1Z,3Z,5Z)-2-methoxyhepta-1,3,5-trienyl]methanimine.
| Compound Name | 1-(1,5-dimethylimidazol-2-yl)-N-[(1Z,3Z,5Z)-2-methoxyhepta-1,3,5-trienyl]methanimine |
|---|---|
| PubChem CID | 89431380 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 1-(1,5-dimethylimidazol-2-yl)-N-[(1Z,3Z,5Z)-2-methoxyhepta-1,3,5-trienyl]methanimine |
| SMILES | C/C=C\C=C/C(=C/N=C/c1ncc(C)n1C)OC |
| InChI | InChI=1S/C14H19N3O/c1-5-6-7-8-13(18-4)10-15-11-14-16-9-12(2)17(14)3/h5-11H,1-4H3/b6-5-,8-7-,13-10-,15-11+ |
| InChIKey | DNZXDMAUHLBQIZ-XTEBRMBTSA-N |
| XLogP | 2.77 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|