C12H17N3O3S — CID 89431478
2,2-dioxo-5-pentan-2-yloxy-1H-2λ6,1,3-benzothiadiazin-4-amine (PubChem CID 89431478) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2,2-dioxo-5-pentan-2-yloxy-1H-2λ6,1,3-benzothiadiazin-4-amine.
| Compound Name | 2,2-dioxo-5-pentan-2-yloxy-1H-2λ6,1,3-benzothiadiazin-4-amine |
|---|---|
| PubChem CID | 89431478 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2,2-dioxo-5-pentan-2-yloxy-1H-2λ6,1,3-benzothiadiazin-4-amine |
| SMILES | CCCC(C)Oc1cccc2c1C(N)=NS(=O)(=O)N2 |
| InChI | InChI=1S/C12H17N3O3S/c1-3-5-8(2)18-10-7-4-6-9-11(10)12(13)15-19(16,17)14-9/h4,6-8,14H,3,5H2,1-2H3,(H2,13,15) |
| InChIKey | VUZGWILDGWFZEO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |