C15H20FN — CID 89431580
4-[(5E,7Z)-6-fluorodeca-5,7,9-trien-3-yl]-2,3-dihydropyridine (PubChem CID 89431580) has the molecular formula C15H20FN and a molecular weight of 233.33 g/mol. Its IUPAC name is 4-[(5E,7Z)-6-fluorodeca-5,7,9-trien-3-yl]-2,3-dihydropyridine.
| Compound Name | 4-[(5E,7Z)-6-fluorodeca-5,7,9-trien-3-yl]-2,3-dihydropyridine |
|---|---|
| PubChem CID | 89431580 |
| Molecular Formula | C15H20FN |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 4-[(5E,7Z)-6-fluorodeca-5,7,9-trien-3-yl]-2,3-dihydropyridine |
| SMILES | C=C/C=C\C(F)=C/CC(CC)C1=CC=NCC1 |
| InChI | InChI=1S/C15H20FN/c1-3-5-6-15(16)8-7-13(4-2)14-9-11-17-12-10-14/h3,5-6,8-9,11,13H,1,4,7,10,12H2,2H3/b6-5-,15-8+ |
| InChIKey | DQDRIPSIWCUIKZ-UGHRRFQNSA-N |
| XLogP | 4.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|