C23H27N — CID 89431640
2-methyl-6-[(9Z,11E,13E)-15-methyl-14-tricyclo[6.6.2.04,16]hexadeca-1,5,9,11,13-pentaenyl]-3,4-dihydropyridine (PubChem CID 89431640) has the molecular formula C23H27N and a molecular weight of 317.48 g/mol. Its IUPAC name is 2-methyl-6-[(9Z,11E,13E)-15-methyl-14-tricyclo[6.6.2.04,16]hexadeca-1,5,9,11,13-pentaenyl]-3,4-dihydropyridine.
| Compound Name | 2-methyl-6-[(9Z,11E,13E)-15-methyl-14-tricyclo[6.6.2.04,16]hexadeca-1,5,9,11,13-pentaenyl]-3,4-dihydropyridine |
|---|---|
| PubChem CID | 89431640 |
| Molecular Formula | C23H27N |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 2-methyl-6-[(9Z,11E,13E)-15-methyl-14-tricyclo[6.6.2.04,16]hexadeca-1,5,9,11,13-pentaenyl]-3,4-dihydropyridine |
| SMILES | CC1=NC(/C2=C/C=C\C=C/C3CC=CC4CC=C2C(C)C43)=CCC1 |
| InChI | InChI=1S/C23H27N/c1-16-8-6-13-22(24-16)21-12-5-3-4-9-18-10-7-11-19-14-15-20(21)17(2)23(18)19/h3-5,7,9,11-13,15,17-19,23H,6,8,10,14H2,1-2H3/b5-3-,9-4-,21-12+ |
| InChIKey | HPUDPDKSWHQWGM-DTTPNFJSSA-N |
| XLogP | 5.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|