C18H16FN5OS — CID 8943196
1-[(4-fluorophenyl)methyl]-3-[(1-phenylpyrazole-4-carbonyl)amino]thiourea (PubChem CID 8943196) has the molecular formula C18H16FN5OS and a molecular weight of 369.43 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[(1-phenylpyrazole-4-carbonyl)amino]thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[(1-phenylpyrazole-4-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 8943196 |
| Molecular Formula | C18H16FN5OS |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[(1-phenylpyrazole-4-carbonyl)amino]thiourea |
| SMILES | O=C(NNC(=S)NCc1ccc(F)cc1)c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H16FN5OS/c19-15-8-6-13(7-9-15)10-20-18(26)23-22-17(25)14-11-21-24(12-14)16-4-2-1-3-5-16/h1-9,11-12H,10H2,(H,22,25)(H2,20,23,26) |
| InChIKey | CZKBXEOOPWNQOS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|