C27H52O2Si — CID 89431987
(12Z,15Z)-4-[tert-butyl(dimethyl)silyl]oxyhenicosa-12,15-dien-2-one (PubChem CID 89431987) has the molecular formula C27H52O2Si and a molecular weight of 436.80 g/mol. Its IUPAC name is (12Z,15Z)-4-[tert-butyl(dimethyl)silyl]oxyhenicosa-12,15-dien-2-one.
| Compound Name | (12Z,15Z)-4-[tert-butyl(dimethyl)silyl]oxyhenicosa-12,15-dien-2-one |
|---|---|
| PubChem CID | 89431987 |
| Molecular Formula | C27H52O2Si |
| Molecular Weight | 436.80 g/mol |
| Exact Mass | 436.37 |
| IUPAC Name | (12Z,15Z)-4-[tert-butyl(dimethyl)silyl]oxyhenicosa-12,15-dien-2-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(CC(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52O2Si/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-26(24-25(2)28)29-30(6,7)27(3,4)5/h12-13,15-16,26H,8-11,14,17-24H2,1-7H3/b13-12-,16-15- |
| InChIKey | KUHJTMHLORRPNO-QGLGPCELSA-N |
| XLogP | 9.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.80 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|