C17H23N2O8P — CID 89432068
2-[1,3-dioxo-4-propan-2-yl-7-[(prop-2-enoylamino)methyl]-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]ethyl dihydrogen phosphate (PubChem CID 89432068) has the molecular formula C17H23N2O8P and a molecular weight of 414.35 g/mol. Its IUPAC name is 2-[1,3-dioxo-4-propan-2-yl-7-[(prop-2-enoylamino)methyl]-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]ethyl dihydrogen phosphate.
| Compound Name | 2-[1,3-dioxo-4-propan-2-yl-7-[(prop-2-enoylamino)methyl]-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 89432068 |
| Molecular Formula | C17H23N2O8P |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-[1,3-dioxo-4-propan-2-yl-7-[(prop-2-enoylamino)methyl]-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]ethyl dihydrogen phosphate |
| SMILES | C=CC(=O)NCC12C=CC(C(C)C)(O1)C1C(=O)N(CCOP(=O)(O)O)C(=O)C12 |
| InChI | InChI=1S/C17H23N2O8P/c1-4-11(20)18-9-16-5-6-17(27-16,10(2)3)13-12(16)14(21)19(15(13)22)7-8-26-28(23,24)25/h4-6,10,12-13H,1,7-9H2,2-3H3,(H,18,20)(H2,23,24,25) |
| InChIKey | BLSFZJBCJBDJHP-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|